C19H14O5S — CID 4766
View drug profile → phenolsulfonphthalein4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol (PubChem CID 4766) has the molecular formula C19H14O5S and a molecular weight of 354.38 g/mol. Its IUPAC name is 4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol.
| Compound Name | 4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol |
|---|---|
| PubChem CID | 4766 |
| Molecular Formula | C19H14O5S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol |
| SMILES | O=S1(=O)OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H14O5S/c20-15-9-5-13(6-10-15)19(14-7-11-16(21)12-8-14)17-3-1-2-4-18(17)25(22,23)24-19/h1-12,20-21H |
| InChIKey | BELBBZDIHDAJOR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_sulfite_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|