About phenylurea
phenylurea (PubChem CID 6145) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is phenylurea.
Molecular Properties
| Compound Name | phenylurea |
| PubChem CID | 6145 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | phenylurea |
| SMILES | NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C7H8N2O/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| InChIKey | LUBJCRLGQSPQNN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylurea?
The IUPAC name of phenylurea (CID 6145) is phenylurea.
What is the SMILES notation for phenylurea?
The canonical SMILES for phenylurea is NC(=O)Nc1ccccc1.
What is the InChIKey of phenylurea?
The InChIKey is LUBJCRLGQSPQNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10).
What are the key properties of phenylurea?
phenylurea has a molecular weight of 136.15 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylurea is sourced from PubChem (CID 6145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).