About phthalazine
phthalazine (PubChem CID 9207) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is phthalazine.
Molecular Properties
| Compound Name | phthalazine |
| PubChem CID | 9207 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | phthalazine |
| SMILES | c1ccc2cnncc2c1 |
| InChI | InChI=1S/C8H6N2/c1-2-4-8-6-10-9-5-7(8)3-1/h1-6H |
| InChIKey | LFSXCDWNBUNEEM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazine?
The IUPAC name of phthalazine (CID 9207) is phthalazine.
What is the SMILES notation for phthalazine?
The canonical SMILES for phthalazine is c1ccc2cnncc2c1.
What is the InChIKey of phthalazine?
The InChIKey is LFSXCDWNBUNEEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-4-8-6-10-9-5-7(8)3-1/h1-6H.
What are the key properties of phthalazine?
phthalazine has a molecular weight of 130.15 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazine is sourced from PubChem (CID 9207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).