About 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine
5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine (PubChem CID 10124) has the molecular formula C9H9N3O2S2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine |
| PubChem CID | 10124 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine |
| SMILES | Nc1ccc(S(=O)(=O)c2cnc(N)s2)cc1 |
| InChI | InChI=1S/C9H9N3O2S2/c10-6-1-3-7(4-2-6)16(13,14)8-5-12-9(11)15-8/h1-5H,10H2,(H2,11,12) |
| InChIKey | KVEZIRCKNOTGKY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine?
The IUPAC name of 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine (CID 10124) is 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine is Nc1ccc(S(=O)(=O)c2cnc(N)s2)cc1.
What is the InChIKey of 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine?
The InChIKey is KVEZIRCKNOTGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S2/c10-6-1-3-7(4-2-6)16(13,14)8-5-12-9(11)15-8/h1-5H,10H2,(H2,11,12).
What are the key properties of 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine?
5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine has a molecular weight of 255.32 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine is sourced from PubChem (CID 10124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).