About 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate
2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate (PubChem CID 17700) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate |
| PubChem CID | 17700 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate |
| SMILES | C#CCOC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c1-4-16-25-21(18-11-7-5-8-12-18,19-13-9-6-10-14-19)20(23)24-17-15-22(2)3/h1,5-14H,15-17H2,2-3H3 |
| InChIKey | QNPHCSSJLHAKSA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
The IUPAC name of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate (CID 17700) is 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
The canonical SMILES for 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate is C#CCOC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
The InChIKey is QNPHCSSJLHAKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3/c1-4-16-25-21(18-11-7-5-8-12-18,19-13-9-6-10-14-19)20(23)24-17-15-22(2)3/h1,5-14H,15-17H2,2-3H3.
What are the key properties of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate has a molecular weight of 337.42 g/mol, XLogP of 2.68, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate is sourced from PubChem (CID 17700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).