C10H14N4O3 — CID 4977
View drug profile → proxyphylline7-(2-hydroxypropyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 4977) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 7-(2-hydroxypropyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(2-hydroxypropyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4977 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 7-(2-hydroxypropyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H14N4O3/c1-6(15)4-14-5-11-8-7(14)9(16)13(3)10(17)12(8)2/h5-6,15H,4H2,1-3H3 |
| InChIKey | KYHQZNGJUGFTGR-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |