About pyrazine-2-carboxamide
pyrazine-2-carboxamide (PubChem CID 1046) has the molecular formula C5H5N3O
and a molecular weight of 123.11 g/mol. Its IUPAC name is pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | pyrazine-2-carboxamide |
| PubChem CID | 1046 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cnccn1 |
| InChI | InChI=1S/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9) |
| InChIKey | IPEHBUMCGVEMRF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine-2-carboxamide?
The IUPAC name of pyrazine-2-carboxamide (CID 1046) is pyrazine-2-carboxamide.
What is the SMILES notation for pyrazine-2-carboxamide?
The canonical SMILES for pyrazine-2-carboxamide is NC(=O)c1cnccn1.
What is the InChIKey of pyrazine-2-carboxamide?
The InChIKey is IPEHBUMCGVEMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9).
What are the key properties of pyrazine-2-carboxamide?
pyrazine-2-carboxamide has a molecular weight of 123.11 g/mol, XLogP of -0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine-2-carboxamide is sourced from PubChem (CID 1046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).