C12H13ClN4 — CID 4993
View drug profile → pyrimethamine5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine (PubChem CID 4993) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 4993 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN4/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | WKSAUQYGYAYLPV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |