C18H34O3 — CID 6917723
View drug profile → rosaprostol7-[(1R,2S)-2-hexyl-5-hydroxycyclopentyl]heptanoic acid (PubChem CID 6917723) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is 7-[(1R,2S)-2-hexyl-5-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S)-2-hexyl-5-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 6917723 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 7-[(1R,2S)-2-hexyl-5-hydroxycyclopentyl]heptanoic acid |
| SMILES | CCCCCC[C@H]1CCC(O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-7-10-15-13-14-17(19)16(15)11-8-5-6-9-12-18(20)21/h15-17,19H,2-14H2,1H3,(H,20,21)/t15-,16+,17?/m0/s1 |
| InChIKey | NMAOJFAMEOVURT-RTKIROINSA-N |
| XLogP | 4.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|