C10H14N2O4S2 — CID 5356
View drug profile → sultiame4-(1,1-dioxothiazinan-2-yl)benzenesulfonamide (PubChem CID 5356) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)benzenesulfonamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5356 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C10H14N2O4S2/c11-18(15,16)10-5-3-9(4-6-10)12-7-1-2-8-17(12,13)14/h3-6H,1-2,7-8H2,(H2,11,15,16) |
| InChIKey | HMHVCUVYZFYAJI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |