C7H16N4O4S2 — CID 29566
View drug profile → taurolidine4-[(1,1-dioxo-1,2,4-thiadiazinan-4-yl)methyl]-1,2,4-thiadiazinane 1,1-dioxide (PubChem CID 29566) has the molecular formula C7H16N4O4S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2,4-thiadiazinan-4-yl)methyl]-1,2,4-thiadiazinane 1,1-dioxide.
| Compound Name | 4-[(1,1-dioxo-1,2,4-thiadiazinan-4-yl)methyl]-1,2,4-thiadiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 29566 |
| Molecular Formula | C7H16N4O4S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-[(1,1-dioxo-1,2,4-thiadiazinan-4-yl)methyl]-1,2,4-thiadiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(CN2CCS(=O)(=O)NC2)CN1 |
| InChI | InChI=1S/C7H16N4O4S2/c12-16(13)3-1-10(5-8-16)7-11-2-4-17(14,15)9-6-11/h8-9H,1-7H2 |
| InChIKey | AJKIRUJIDFJUKJ-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |