C7H4ClNOS — CID 6258
View drug profile → ticlatone6-chloro-1,2-benzothiazol-3-one (PubChem CID 6258) has the molecular formula C7H4ClNOS and a molecular weight of 185.64 g/mol. Its IUPAC name is 6-chloro-1,2-benzothiazol-3-one.
| Compound Name | 6-chloro-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 6258 |
| Molecular Formula | C7H4ClNOS |
| Molecular Weight | 185.64 g/mol |
| Exact Mass | 184.97 |
| IUPAC Name | 6-chloro-1,2-benzothiazol-3-one |
| SMILES | O=c1[nH]sc2cc(Cl)ccc12 |
| InChI | InChI=1S/C7H4ClNOS/c8-4-1-2-5-6(3-4)11-9-7(5)10/h1-3H,(H,9,10) |
| InChIKey | POPOYOKQQAEISW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |