C18H24NO2S+ — CID 5473
View drug profile → tiemonium3-(4-methylmorpholin-4-ium-4-yl)-1-phenyl-1-thiophen-2-ylpropan-1-ol (PubChem CID 5473) has the molecular formula C18H24NO2S+ and a molecular weight of 318.46 g/mol. Its IUPAC name is 3-(4-methylmorpholin-4-ium-4-yl)-1-phenyl-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 3-(4-methylmorpholin-4-ium-4-yl)-1-phenyl-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 5473 |
| Molecular Formula | C18H24NO2S+ |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-(4-methylmorpholin-4-ium-4-yl)-1-phenyl-1-thiophen-2-ylpropan-1-ol |
| SMILES | C[N+]1(CCC(O)(c2ccccc2)c2cccs2)CCOCC1 |
| InChI | InChI=1S/C18H24NO2S/c1-19(11-13-21-14-12-19)10-9-18(20,17-8-5-15-22-17)16-6-3-2-4-7-16/h2-8,15,20H,9-14H2,1H3/q+1 |
| InChIKey | HJDYAOBDPZQHOD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|