C16H20N4O3S — CID 51371498
View drug profile → torsemideN-[4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-N'-propan-2-ylcarbamimidate (PubChem CID 51371498) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-N'-propan-2-ylcarbamimidate.
| Compound Name | N-[4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-N'-propan-2-ylcarbamimidate |
|---|---|
| PubChem CID | 51371498 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-N'-propan-2-ylcarbamimidate |
| SMILES | Cc1cccc(Nc2cc[nH+]cc2S(=O)(=O)N/C([O-])=N/C(C)C)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-11(2)18-16(21)20-24(22,23)15-10-17-8-7-14(15)19-13-6-4-5-12(3)9-13/h4-11H,1-3H3,(H,17,19)(H2,18,20,21) |
| InChIKey | NGBFQHCMQULJNZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|