C2HCl3 — CID 6575
View drug profile → trichloroethylene1,1,2-trichloroethene (PubChem CID 6575) has the molecular formula C2HCl3 and a molecular weight of 131.39 g/mol. Its IUPAC name is 1,1,2-trichloroethene.
| Compound Name | 1,1,2-trichloroethene |
|---|---|
| PubChem CID | 6575 |
| Molecular Formula | C2HCl3 |
| Molecular Weight | 131.39 g/mol |
| Exact Mass | 129.91 |
| IUPAC Name | 1,1,2-trichloroethene |
| SMILES | ClC=C(Cl)Cl |
| InChI | InChI=1S/C2HCl3/c3-1-2(4)5/h1H |
| InChIKey | XSTXAVWGXDQKEL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |