C9H12N6 — CID 5799
View drug profile → tretamine2,4,6-tris(aziridin-1-yl)-1,3,5-triazine (PubChem CID 5799) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is 2,4,6-tris(aziridin-1-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 5799 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
| SMILES | C1CN1c1nc(N2CC2)nc(N2CC2)n1 |
| InChI | InChI=1S/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
| InChIKey | IUCJMVBFZDHPDX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 47.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|