About triphenylstannane
triphenylstannane (PubChem CID 6460) has the molecular formula C18H16Sn
and a molecular weight of 351.04 g/mol. Its IUPAC name is triphenylstannane.
Molecular Properties
| Compound Name | triphenylstannane |
| PubChem CID | 6460 |
| Molecular Formula | C18H16Sn |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | triphenylstannane |
| SMILES | c1ccc([SnH](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.Sn.H/c3*1-2-4-6-5-3-1;;/h3*1-5H;; |
| InChIKey | NFHRNKANAAGQOH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze triphenylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylstannane?
The IUPAC name of triphenylstannane (CID 6460) is triphenylstannane.
What is the SMILES notation for triphenylstannane?
The canonical SMILES for triphenylstannane is c1ccc([SnH](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylstannane?
The InChIKey is NFHRNKANAAGQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.Sn.H/c3*1-2-4-6-5-3-1;;/h3*1-5H;;.
What are the key properties of triphenylstannane?
triphenylstannane has a molecular weight of 351.04 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylstannane is sourced from PubChem (CID 6460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).