C14H16N2O9 — CID 23279496
View drug profile → uridine triacetate[(2R,3R,4S,5R)-4,5-diacetyloxy-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 23279496) has the molecular formula C14H16N2O9 and a molecular weight of 356.29 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5-diacetyloxy-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 23279496 |
| Molecular Formula | C14H16N2O9 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H16N2O9/c1-6(17)22-10-11(23-7(2)18)13(24-8(3)19)25-12(10)16-5-4-9(20)15-14(16)21/h4-5,10-13H,1-3H3,(H,15,20,21)/t10-,11+,12-,13+/m1/s1 |
| InChIKey | BKCXTZWLBPOGRU-XQHKEYJVSA-N |
| XLogP | -1.18 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|