C17H14O3S — CID 5720
View drug profile → zaltoprofen2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid (PubChem CID 5720) has the molecular formula C17H14O3S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid.
| Compound Name | 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 5720 |
| Molecular Formula | C17H14O3S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2 |
| InChI | InChI=1S/C17H14O3S/c1-10(17(19)20)11-6-7-15-12(8-11)9-14(18)13-4-2-3-5-16(13)21-15/h2-8,10H,9H2,1H3,(H,19,20) |
| InChIKey | MUXFZBHBYYYLTH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |