C17H27O6PS — CID 10000463
S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] benzenecarbothioate (PubChem CID 10000463) has the molecular formula C17H27O6PS and a molecular weight of 390.44 g/mol. Its IUPAC name is S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] benzenecarbothioate.
| Compound Name | S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 10000463 |
| Molecular Formula | C17H27O6PS |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] benzenecarbothioate |
| SMILES | CCCCCCOC[C@H](COP(=O)(O)OC)SC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H27O6PS/c1-3-4-5-9-12-22-13-16(14-23-24(19,20)21-2)25-17(18)15-10-7-6-8-11-15/h6-8,10-11,16H,3-5,9,12-14H2,1-2H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | RLUYSTOIWIWGFI-MRXNPFEDSA-N |
| XLogP | 4.29 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|