C15H29O6PS — CID 10451661
S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (E)-pent-2-enethioate (PubChem CID 10451661) has the molecular formula C15H29O6PS and a molecular weight of 368.43 g/mol. Its IUPAC name is S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (E)-pent-2-enethioate.
| Compound Name | S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (E)-pent-2-enethioate |
|---|---|
| PubChem CID | 10451661 |
| Molecular Formula | C15H29O6PS |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | S-[(2R)-1-hexoxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (E)-pent-2-enethioate |
| SMILES | CC/C=C/C(=O)SC(COCCCCCC)COP(=O)(O)OC |
| InChI | InChI=1S/C15H29O6PS/c1-4-6-8-9-11-20-12-14(13-21-22(17,18)19-3)23-15(16)10-7-5-2/h7,10,14H,4-6,8-9,11-13H2,1-3H3,(H,17,18)/b10-7+ |
| InChIKey | RDRORTLBEYBBJL-JXMROGBWSA-N |
| XLogP | 3.94 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|