C24H53NO5PS+ — CID 10097395
2-[hydroxy-(3-octoxy-2-octylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 10097395) has the molecular formula C24H53NO5PS+ and a molecular weight of 498.73 g/mol. Its IUPAC name is 2-[hydroxy-(3-octoxy-2-octylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-(3-octoxy-2-octylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 10097395 |
| Molecular Formula | C24H53NO5PS+ |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | 2-[hydroxy-(3-octoxy-2-octylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)SCCCCCCCC |
| InChI | InChI=1S/C24H52NO5PS/c1-6-8-10-12-14-16-19-28-22-24(32-21-17-15-13-11-9-7-2)23-30-31(26,27)29-20-18-25(3,4)5/h24H,6-23H2,1-5H3/p+1 |
| InChIKey | BWGNHRJBHCUOJK-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|