C28H61NO6P+ — CID 137333771
2-[[(2R)-2,3-didecoxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 137333771) has the molecular formula C28H61NO6P+ and a molecular weight of 538.77 g/mol. Its IUPAC name is 2-[[(2R)-2,3-didecoxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-didecoxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 137333771 |
| Molecular Formula | C28H61NO6P+ |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | 2-[[(2R)-2,3-didecoxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCCOC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OCCCCCCCCCC |
| InChI | InChI=1S/C28H60NO6P/c1-6-8-10-12-14-16-18-20-23-32-26-28(33-24-21-19-17-15-13-11-9-7-2)27-35-36(30,31)34-25-22-29(3,4)5/h28H,6-27H2,1-5H3/p+1/t28-/m1/s1 |
| InChIKey | BUMZTVBKMJFBMI-MUUNZHRXSA-O |
| XLogP | 7.51 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|