C22H48NO6P — CID 24779437
[(2R)-2,3-diheptoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 24779437) has the molecular formula C22H48NO6P and a molecular weight of 453.60 g/mol. Its IUPAC name is [(2R)-2,3-diheptoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2,3-diheptoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 24779437 |
| Molecular Formula | C22H48NO6P |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | [(2R)-2,3-diheptoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCOC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OCCCCCCC |
| InChI | InChI=1S/C22H48NO6P/c1-6-8-10-12-14-17-26-20-22(27-18-15-13-11-9-7-2)21-29-30(24,25)28-19-16-23(3,4)5/h22H,6-21H2,1-5H3/t22-/m1/s1 |
| InChIKey | QUDTTWVDTZBUFG-JOCHJYFZSA-N |
| XLogP | 4.54 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|