C20H44NO6P — CID 16666988
2,3-dihexoxypropyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 16666988) has the molecular formula C20H44NO6P and a molecular weight of 425.55 g/mol. Its IUPAC name is 2,3-dihexoxypropyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2,3-dihexoxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 16666988 |
| Molecular Formula | C20H44NO6P |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 2,3-dihexoxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OCCCCCC |
| InChI | InChI=1S/C20H44NO6P/c1-6-8-10-12-15-24-18-20(25-16-13-11-9-7-2)19-27-28(22,23)26-17-14-21(3,4)5/h20H,6-19H2,1-5H3 |
| InChIKey | IQYIEYGHUQSRSF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|