C18H40NO6P — CID 5027624
(2-methoxy-3-nonoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 5027624) has the molecular formula C18H40NO6P and a molecular weight of 397.49 g/mol. Its IUPAC name is (2-methoxy-3-nonoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | (2-methoxy-3-nonoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 5027624 |
| Molecular Formula | C18H40NO6P |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2-methoxy-3-nonoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC |
| InChI | InChI=1S/C18H40NO6P/c1-6-7-8-9-10-11-12-14-23-16-18(22-5)17-25-26(20,21)24-15-13-19(2,3)4/h18H,6-17H2,1-5H3 |
| InChIKey | LTCDSUZIFHLDRH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|