C18H38NO8P — CID 88694898
(2-methoxycarbonyloxy-3-octoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 88694898) has the molecular formula C18H38NO8P and a molecular weight of 427.48 g/mol. Its IUPAC name is (2-methoxycarbonyloxy-3-octoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | (2-methoxycarbonyloxy-3-octoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 88694898 |
| Molecular Formula | C18H38NO8P |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (2-methoxycarbonyloxy-3-octoxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)OC |
| InChI | InChI=1S/C18H38NO8P/c1-6-7-8-9-10-11-13-24-15-17(27-18(20)23-5)16-26-28(21,22)25-14-12-19(2,3)4/h17H,6-16H2,1-5H3 |
| InChIKey | DBWBVDZYJSBJOA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|