C27H56NO6P — CID 10075413
[2-methoxy-3-[(E)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 10075413) has the molecular formula C27H56NO6P and a molecular weight of 521.72 g/mol. Its IUPAC name is [2-methoxy-3-[(E)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-methoxy-3-[(E)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 10075413 |
| Molecular Formula | C27H56NO6P |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.38 |
| IUPAC Name | [2-methoxy-3-[(E)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCC/C=C/CCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC |
| InChI | InChI=1S/C27H56NO6P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-32-25-27(31-5)26-34-35(29,30)33-24-22-28(2,3)4/h15-16,27H,6-14,17-26H2,1-5H3/b16-15+ |
| InChIKey | ZSTLCIGSZZGSOP-FOCLMDBBSA-N |
| XLogP | 6.26 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|