C26H57NO6PS+ — CID 88727792
2-[hydroxy-[2-methoxy-3-(8-nonoxyoctylsulfanyl)propoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 88727792) has the molecular formula C26H57NO6PS+ and a molecular weight of 542.78 g/mol. Its IUPAC name is 2-[hydroxy-[2-methoxy-3-(8-nonoxyoctylsulfanyl)propoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-methoxy-3-(8-nonoxyoctylsulfanyl)propoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 88727792 |
| Molecular Formula | C26H57NO6PS+ |
| Molecular Weight | 542.78 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | 2-[hydroxy-[2-methoxy-3-(8-nonoxyoctylsulfanyl)propoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCOCCCCCCCCSCC(COP(=O)(O)OCC[N+](C)(C)C)OC |
| InChI | InChI=1S/C26H56NO6PS/c1-6-7-8-9-10-13-16-20-31-21-17-14-11-12-15-18-23-35-25-26(30-5)24-33-34(28,29)32-22-19-27(2,3)4/h26H,6-25H2,1-5H3/p+1 |
| InChIKey | ATGLYJFORITEQI-UHFFFAOYSA-O |
| XLogP | 6.68 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|