C28H59NO6P+ — CID 91478791
2-[hydroxy-[(2R)-2-methoxy-3-nonadec-10-enoxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 91478791) has the molecular formula C28H59NO6P+ and a molecular weight of 536.76 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-methoxy-3-nonadec-10-enoxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-methoxy-3-nonadec-10-enoxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 91478791 |
| Molecular Formula | C28H59NO6P+ |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-methoxy-3-nonadec-10-enoxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCCCOC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC |
| InChI | InChI=1S/C28H58NO6P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-33-26-28(32-5)27-35-36(30,31)34-25-23-29(2,3)4/h13-14,28H,6-12,15-27H2,1-5H3/p+1/t28-/m1/s1 |
| InChIKey | LFNSDXXOIHLSDS-MUUNZHRXSA-O |
| XLogP | 7.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|