C37H75NO6P+ — CID 87062697
2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 87062697) has the molecular formula C37H75NO6P+ and a molecular weight of 660.98 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87062697 |
| Molecular Formula | C37H75NO6P+ |
| Molecular Weight | 660.98 g/mol |
| Exact Mass | 660.53 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C\CCCCCCCCCC/C=C\CCCCCOC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C37H74NO6P/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-32-41-34-36(44-37(2,3)4)35-43-45(39,40)42-33-31-38(5,6)7/h13-14,25-26,36H,8-12,15-24,27-35H2,1-7H3/p+1/b14-13-,26-25-/t36-/m1/s1 |
| InChIKey | RNSGXKFWRZRXIY-VLUAJYTQSA-O |
| XLogP | 10.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.98 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|