C33H69NO6P+ — CID 87062488
2-[[(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 87062488) has the molecular formula C33H69NO6P+ and a molecular weight of 606.89 g/mol. Its IUPAC name is 2-[[(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87062488 |
| Molecular Formula | C33H69NO6P+ |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.49 |
| IUPAC Name | 2-[[(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCCOC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C33H68NO6P/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-28-37-30-32(40-33(2,3)4)31-39-41(35,36)38-29-27-34(5,6)7/h17-18,32H,8-16,19-31H2,1-7H3/p+1/b18-17-/t32-/m1/s1 |
| InChIKey | HEPKBWAMKLXOCH-JEDOJCDQSA-O |
| XLogP | 9.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|