C33H67NO6P+ — CID 91049672
2-[[(2R)-3-henicosa-9,15-dienoxy-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 91049672) has the molecular formula C33H67NO6P+ and a molecular weight of 604.87 g/mol. Its IUPAC name is 2-[[(2R)-3-henicosa-9,15-dienoxy-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-henicosa-9,15-dienoxy-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 91049672 |
| Molecular Formula | C33H67NO6P+ |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.47 |
| IUPAC Name | 2-[[(2R)-3-henicosa-9,15-dienoxy-2-[(2-methylpropan-2-yl)oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC=CCCCCC=CCCCCCCCCOC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C33H66NO6P/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-28-37-30-32(40-33(2,3)4)31-39-41(35,36)38-29-27-34(5,6)7/h12-13,18-19,32H,8-11,14-17,20-31H2,1-7H3/p+1/t32-/m1/s1 |
| InChIKey | QJAIANXDWQXOMY-JGCGQSQUSA-O |
| XLogP | 9.01 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|