C31H63NO6P+ — CID 91169674
2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-nonadeca-6,12-dienoxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 91169674) has the molecular formula C31H63NO6P+ and a molecular weight of 576.82 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-nonadeca-6,12-dienoxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-nonadeca-6,12-dienoxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 91169674 |
| Molecular Formula | C31H63NO6P+ |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-nonadeca-6,12-dienoxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCC=CCCCCC=CCCCCCOC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C31H62NO6P/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-35-28-30(38-31(2,3)4)29-37-39(33,34)36-27-25-32(5,6)7/h13-14,19-20,30H,8-12,15-18,21-29H2,1-7H3/p+1/t30-/m1/s1 |
| InChIKey | ZMHPFHPIJQSXRP-SSEXGKCCSA-O |
| XLogP | 8.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|