C14H27O6PS2 — CID 10000219
S-[(2S)-3-[hydroxy(methoxy)phosphoryl]oxy-2-pentanoylsulfanylpropyl] pentanethioate (PubChem CID 10000219) has the molecular formula C14H27O6PS2 and a molecular weight of 386.47 g/mol. Its IUPAC name is S-[(2S)-3-[hydroxy(methoxy)phosphoryl]oxy-2-pentanoylsulfanylpropyl] pentanethioate.
| Compound Name | S-[(2S)-3-[hydroxy(methoxy)phosphoryl]oxy-2-pentanoylsulfanylpropyl] pentanethioate |
|---|---|
| PubChem CID | 10000219 |
| Molecular Formula | C14H27O6PS2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | S-[(2S)-3-[hydroxy(methoxy)phosphoryl]oxy-2-pentanoylsulfanylpropyl] pentanethioate |
| SMILES | CCCCC(=O)SC[C@H](COP(=O)(O)OC)SC(=O)CCCC |
| InChI | InChI=1S/C14H27O6PS2/c1-4-6-8-13(15)22-11-12(10-20-21(17,18)19-3)23-14(16)9-7-5-2/h12H,4-11H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | SMKPZZYHPPCXNY-LBPRGKRZSA-N |
| XLogP | 4.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|