About S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate
S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate (PubChem CID 135746104) has the molecular formula C23H45O6PS2
and a molecular weight of 512.72 g/mol. Its IUPAC name is S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate.
Molecular Properties
| Compound Name | S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate |
| PubChem CID | 135746104 |
| Molecular Formula | C23H45O6PS2 |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate |
| SMILES | CCCCCCCCC(=O)SC[C@@H](COP(=O)(OC)OC)SC(=O)CCCCCCCC |
| InChI | InChI=1S/C23H45O6PS2/c1-5-7-9-11-13-15-17-22(24)31-20-21(19-29-30(26,27-3)28-4)32-23(25)18-16-14-12-10-8-6-2/h21H,5-20H2,1-4H3/t21-/m1/s1 |
| InChIKey | MJDDXJPTGASPLT-OAQYLSRUSA-N |
| XLogP | 7.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate?
The IUPAC name of S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate (CID 135746104) is S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate.
What is the SMILES notation for S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate?
The canonical SMILES for S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate is CCCCCCCCC(=O)SC[C@@H](COP(=O)(OC)OC)SC(=O)CCCCCCCC.
What is the InChIKey of S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate?
The InChIKey is MJDDXJPTGASPLT-OAQYLSRUSA-N. The full InChI is InChI=1S/C23H45O6PS2/c1-5-7-9-11-13-15-17-22(24)31-20-21(19-29-30(26,27-3)28-4)32-23(25)18-16-14-12-10-8-6-2/h21H,5-20H2,1-4H3/t21-/m1/s1.
What are the key properties of S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate?
S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate has a molecular weight of 512.72 g/mol, XLogP of 7.79, 22 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R)-3-dimethoxyphosphoryloxy-2-nonanoylsulfanylpropyl] nonanethioate is sourced from PubChem (CID 135746104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).