C20H38NaO8PS2 — CID 172873656
sodium [(2S)-2,3-bis(heptanoylsulfanyl)propyl] 2,3-dihydroxypropyl phosphate (PubChem CID 172873656) has the molecular formula C20H38NaO8PS2 and a molecular weight of 524.61 g/mol. Its IUPAC name is sodium [(2S)-2,3-bis(heptanoylsulfanyl)propyl] 2,3-dihydroxypropyl phosphate.
| Compound Name | sodium [(2S)-2,3-bis(heptanoylsulfanyl)propyl] 2,3-dihydroxypropyl phosphate |
|---|---|
| PubChem CID | 172873656 |
| Molecular Formula | C20H38NaO8PS2 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | sodium [(2S)-2,3-bis(heptanoylsulfanyl)propyl] 2,3-dihydroxypropyl phosphate |
| SMILES | CCCCCCC(=O)SC[C@H](COP(=O)([O-])OCC(O)CO)SC(=O)CCCCCC.[Na+] |
| InChI | InChI=1S/C20H39O8PS2.Na/c1-3-5-7-9-11-19(23)30-16-18(31-20(24)12-10-8-6-4-2)15-28-29(25,26)27-14-17(22)13-21;/h17-18,21-22H,3-16H2,1-2H3,(H,25,26);/q;+1/p-1/t17?,18-;/m0./s1 |
| InChIKey | SPKCIJIUMWAHSF-SZOUEMSFSA-M |
| XLogP | 0.67 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|