C22H42O9P- — CID 146036991
[(2S)-2,3-dihydroxypropyl] [(2R)-2-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropyl] phosphate (PubChem CID 146036991) has the molecular formula C22H42O9P- and a molecular weight of 481.54 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] [(2R)-2-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropyl] phosphate.
| Compound Name | [(2S)-2,3-dihydroxypropyl] [(2R)-2-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropyl] phosphate |
|---|---|
| PubChem CID | 146036991 |
| Molecular Formula | C22H42O9P- |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] [(2R)-2-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropyl] phosphate |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)O[C@H](CO)COP(=O)([O-])OC[C@@H](O)CO |
| InChI | InChI=1S/C22H43O9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22(26)31-21(17-24)19-30-32(27,28)29-18-20(25)16-23/h7-8,20-21,23-25H,2-6,9-19H2,1H3,(H,27,28)/p-1/b8-7+/t20-,21+/m0/s1 |
| InChIKey | ODSTWKSGFQDYQP-JLXVBKPDSA-M |
| XLogP | 3.00 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|