C24H46O6 — CID 91034799
[1-(2,3-dihydroxypropoxy)-3-hydroxypropan-2-yl] octadec-9-enoate (PubChem CID 91034799) has the molecular formula C24H46O6 and a molecular weight of 430.63 g/mol. Its IUPAC name is [1-(2,3-dihydroxypropoxy)-3-hydroxypropan-2-yl] octadec-9-enoate.
| Compound Name | [1-(2,3-dihydroxypropoxy)-3-hydroxypropan-2-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 91034799 |
| Molecular Formula | C24H46O6 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | [1-(2,3-dihydroxypropoxy)-3-hydroxypropan-2-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(CO)COCC(O)CO |
| InChI | InChI=1S/C24H46O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(28)30-23(19-26)21-29-20-22(27)18-25/h9-10,22-23,25-27H,2-8,11-21H2,1H3 |
| InChIKey | HNCWLKMZDARSDR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|