C39H72O5 — CID 138167541
[1-[(Z)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (Z)-nonadec-9-enoate (PubChem CID 138167541) has the molecular formula C39H72O5 and a molecular weight of 621.00 g/mol. Its IUPAC name is [1-[(Z)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (Z)-nonadec-9-enoate.
| Compound Name | [1-[(Z)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (Z)-nonadec-9-enoate |
|---|---|
| PubChem CID | 138167541 |
| Molecular Formula | C39H72O5 |
| Molecular Weight | 621.00 g/mol |
| Exact Mass | 620.54 |
| IUPAC Name | [1-[(Z)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (Z)-nonadec-9-enoate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C39H72O5/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-39(42)44-37(35-40)36-43-38(41)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h16,18-20,37,40H,3-15,17,21-36H2,1-2H3/b18-16-,20-19- |
| InChIKey | HEPGGAWDOZGODT-FRKBGCJLSA-N |
| XLogP | 11.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.00 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|