C32H60O5 — CID 134757492
[(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (E)-octadec-11-enoate (PubChem CID 134757492) has the molecular formula C32H60O5 and a molecular weight of 524.83 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (E)-octadec-11-enoate.
| Compound Name | [(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (E)-octadec-11-enoate |
|---|---|
| PubChem CID | 134757492 |
| Molecular Formula | C32H60O5 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.44 |
| IUPAC Name | [(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (E)-octadec-11-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C32H60O5/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-25-27-32(35)37-30(28-33)29-36-31(34)26-24-22-20-12-10-8-6-4-2/h13-14,30,33H,3-12,15-29H2,1-2H3/b14-13+/t30-/m0/s1 |
| InChIKey | PCYDMXLOOXHBEB-QGEMAQJBSA-N |
| XLogP | 9.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|