C29H54O5 — CID 138207911
(1-decanoyloxy-3-hydroxypropan-2-yl) (Z)-hexadec-9-enoate (PubChem CID 138207911) has the molecular formula C29H54O5 and a molecular weight of 482.75 g/mol. Its IUPAC name is (1-decanoyloxy-3-hydroxypropan-2-yl) (Z)-hexadec-9-enoate.
| Compound Name | (1-decanoyloxy-3-hydroxypropan-2-yl) (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 138207911 |
| Molecular Formula | C29H54O5 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.40 |
| IUPAC Name | (1-decanoyloxy-3-hydroxypropan-2-yl) (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC(CO)COC(=O)CCCCCCCCC |
| InChI | InChI=1S/C29H54O5/c1-3-5-7-9-11-12-13-14-15-16-18-20-22-24-29(32)34-27(25-30)26-33-28(31)23-21-19-17-10-8-6-4-2/h12-13,27,30H,3-11,14-26H2,1-2H3/b13-12- |
| InChIKey | LZTIRUMNRWIXEF-SEYXRHQNSA-N |
| XLogP | 7.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|