C40H74O5 — CID 134726592
[(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (E)-icos-11-enoate (PubChem CID 134726592) has the molecular formula C40H74O5 and a molecular weight of 635.03 g/mol. Its IUPAC name is [(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (E)-icos-11-enoate.
| Compound Name | [(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134726592 |
| Molecular Formula | C40H74O5 |
| Molecular Weight | 635.03 g/mol |
| Exact Mass | 634.55 |
| IUPAC Name | [(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (E)-icos-11-enoate |
| SMILES | CCCCCCC/C=C/CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C40H74O5/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-40(43)45-38(36-41)37-44-39(42)34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h16-19,38,41H,3-15,20-37H2,1-2H3/b18-16+,19-17+/t38-/m0/s1 |
| InChIKey | DGLIVSVYRFYEIU-SUQIAPOUSA-N |
| XLogP | 11.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.03 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|