C42H76O8 — CID 171042175
1,3-dihydroxypropan-2-yl (9Z,12Z)-octadeca-9,12-dienoate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 171042175) has the molecular formula C42H76O8 and a molecular weight of 709.06 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (9Z,12Z)-octadeca-9,12-dienoate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (9Z,12Z)-octadeca-9,12-dienoate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 171042175 |
| Molecular Formula | C42H76O8 |
| Molecular Weight | 709.06 g/mol |
| Exact Mass | 708.55 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (9Z,12Z)-octadeca-9,12-dienoate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CO)CO.CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/2C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h2*6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b2*7-6-,10-9- |
| InChIKey | UNSPCOXBTJAMFV-XRHABHTOSA-N |
| XLogP | 9.39 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.06 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|