C45H74O5 — CID 85034258
(1-hydroxy-3-icosa-8,11,14-trienoyloxypropan-2-yl) docosa-7,10,13,16-tetraenoate (PubChem CID 85034258) has the molecular formula C45H74O5 and a molecular weight of 695.08 g/mol. Its IUPAC name is (1-hydroxy-3-icosa-8,11,14-trienoyloxypropan-2-yl) docosa-7,10,13,16-tetraenoate.
| Compound Name | (1-hydroxy-3-icosa-8,11,14-trienoyloxypropan-2-yl) docosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 85034258 |
| Molecular Formula | C45H74O5 |
| Molecular Weight | 695.08 g/mol |
| Exact Mass | 694.55 |
| IUPAC Name | (1-hydroxy-3-icosa-8,11,14-trienoyloxypropan-2-yl) docosa-7,10,13,16-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OC(CO)COC(=O)CCCCCCC=CCC=CCC=CCCCCC |
| InChI | InChI=1S/C45H74O5/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-45(48)50-43(41-46)42-49-44(47)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,22,24-25,27-28,30,43,46H,3-10,15-16,21,23,26,29,31-42H2,1-2H3 |
| InChIKey | IUQSOYMQPQLRSB-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.08 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|