C38H68O5 — CID 138128569
[1-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate (PubChem CID 138128569) has the molecular formula C38H68O5 and a molecular weight of 604.96 g/mol. Its IUPAC name is [1-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate.
| Compound Name | [1-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138128569 |
| Molecular Formula | C38H68O5 |
| Molecular Weight | 604.96 g/mol |
| Exact Mass | 604.51 |
| IUPAC Name | [1-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CO)COC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C38H68O5/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-38(41)43-36(34-39)35-42-37(40)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h13-16,18-19,36,39H,3-12,17,20-35H2,1-2H3/b15-13-,16-14-,19-18- |
| InChIKey | BNWYKSDYZJFJLD-OBMQDGOVSA-N |
| XLogP | 10.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.96 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|