C27H50O5 — CID 138161527
(1-heptanoyloxy-3-hydroxypropan-2-yl) (Z)-heptadec-9-enoate (PubChem CID 138161527) has the molecular formula C27H50O5 and a molecular weight of 454.69 g/mol. Its IUPAC name is (1-heptanoyloxy-3-hydroxypropan-2-yl) (Z)-heptadec-9-enoate.
| Compound Name | (1-heptanoyloxy-3-hydroxypropan-2-yl) (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 138161527 |
| Molecular Formula | C27H50O5 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | (1-heptanoyloxy-3-hydroxypropan-2-yl) (Z)-heptadec-9-enoate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)OC(CO)COC(=O)CCCCCC |
| InChI | InChI=1S/C27H50O5/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-20-22-27(30)32-25(23-28)24-31-26(29)21-19-8-6-4-2/h12-13,25,28H,3-11,14-24H2,1-2H3/b13-12- |
| InChIKey | GLZMHTJYSQYKFW-SEYXRHQNSA-N |
| XLogP | 7.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|