C24H46NaO9P — CID 139035771
sodium 2,3-dihydroxypropyl (2-hydroxy-3-octadec-9-enoyloxypropyl) phosphate (PubChem CID 139035771) has the molecular formula C24H46NaO9P and a molecular weight of 532.59 g/mol. Its IUPAC name is sodium 2,3-dihydroxypropyl (2-hydroxy-3-octadec-9-enoyloxypropyl) phosphate.
| Compound Name | sodium 2,3-dihydroxypropyl (2-hydroxy-3-octadec-9-enoyloxypropyl) phosphate |
|---|---|
| PubChem CID | 139035771 |
| Molecular Formula | C24H46NaO9P |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | sodium 2,3-dihydroxypropyl (2-hydroxy-3-octadec-9-enoyloxypropyl) phosphate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(O)COP(=O)([O-])OCC(O)CO.[Na+] |
| InChI | InChI=1S/C24H47O9P.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(28)31-19-23(27)21-33-34(29,30)32-20-22(26)18-25;/h9-10,22-23,25-27H,2-8,11-21H2,1H3,(H,29,30);/q;+1/p-1 |
| InChIKey | STLDIXSFXILIFT-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|