C21H39O7P-2 — CID 129320279
[(2R)-2-hydroxy-3-[(E)-octadec-11-enoyl]oxypropyl] phosphate (PubChem CID 129320279) has the molecular formula C21H39O7P-2 and a molecular weight of 434.51 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-[(E)-octadec-11-enoyl]oxypropyl] phosphate.
| Compound Name | [(2R)-2-hydroxy-3-[(E)-octadec-11-enoyl]oxypropyl] phosphate |
|---|---|
| PubChem CID | 129320279 |
| Molecular Formula | C21H39O7P-2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | [(2R)-2-hydroxy-3-[(E)-octadec-11-enoyl]oxypropyl] phosphate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OC[C@@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C21H41O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26/h7-8,20,22H,2-6,9-19H2,1H3,(H2,24,25,26)/p-2/b8-7+/t20-/m1/s1 |
| InChIKey | LWSYATLSXCUNTB-AQKVLALTSA-L |
| XLogP | 3.77 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|