C19H35O7P-2 — CID 146036944
[(2R)-3-[(E)-hexadec-9-enoyl]oxy-2-hydroxypropyl] phosphate (PubChem CID 146036944) has the molecular formula C19H35O7P-2 and a molecular weight of 406.46 g/mol. Its IUPAC name is [(2R)-3-[(E)-hexadec-9-enoyl]oxy-2-hydroxypropyl] phosphate.
| Compound Name | [(2R)-3-[(E)-hexadec-9-enoyl]oxy-2-hydroxypropyl] phosphate |
|---|---|
| PubChem CID | 146036944 |
| Molecular Formula | C19H35O7P-2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [(2R)-3-[(E)-hexadec-9-enoyl]oxy-2-hydroxypropyl] phosphate |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)OC[C@@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C19H37O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(21)25-16-18(20)17-26-27(22,23)24/h7-8,18,20H,2-6,9-17H2,1H3,(H2,22,23,24)/p-2/b8-7+/t18-/m1/s1 |
| InChIKey | GLGQZYWTNAOWHT-LKGOPFMKSA-L |
| XLogP | 2.99 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|